Triclosan methyl D3 (methoxy D3)
| Catalog Number |
ACM1020720006-2 |
| CAS |
1020720-00-6 |
| Structure |
 |
| Synonyms |
Benzene, 4-chloro-1-(2,4-dichlorophenoxy)-2-(methoxy-d3)-, Triclosan methyl D3 (methoxy D3), Triclosan Methyl-d3 Ether |
| IUPAC Name |
2,4-dichloro-1-[4-chloro-2-(trideuteriomethoxy)phenoxy]benzene |
| Molecular Weight |
306.59 |
| Molecular Formula |
C13D3H6Cl3O2 |
| Canonical SMILES |
[2H]C([2H])([2H])Oc1cc(Cl)ccc1Oc2ccc(Cl)cc2Cl |
| InChI |
InChI=1S/C13H9Cl3O2/c1-17-13-7-9(15)3-5-12(13)18-11-4-2-8(14)6-10(11)16/h2-7H,1H3/i1D3 |
| Storage |
+20 °C |
| Accurate Mass |
304.9856 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
