Triclosan D3 (2,4-dichlorophenoxy D3) 100 µg/mL in Cyclohexane
| Catalog Number |
ACM1020719985-1 |
| CAS |
1020719-98-5 |
| Structure |
 |
| IUPAC Name |
5-chloro-2-(2,4-dichloro-3,5,6-trideuteriophenoxy)phenol |
| Molecular Weight |
292.56 |
| Molecular Formula |
C12D3H4Cl3O2 |
| Canonical SMILES |
[2H]c1c([2H])c(Oc2ccc(Cl)cc2O)c(Cl)c([2H])c1Cl |
| InChI |
InChI=1S/C12H7Cl3O2/c13-7-1-3-11(9(15)5-7)17-12-4-2-8(14)6-10(12)16/h1-6,16H/i1D,3D,5D |
| Storage |
+20 °C |
| Accurate Mass |
290.97 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
3380-34-5 |
Please kindly note that our products and services are for research use only.
