| Catalog Number |
ACM69193868-1 |
| CAS |
69193-86-8 |
| Structure |
 |
| Synonyms |
Thiram D12 |
| IUPAC Name |
bis(trideuteriomethyl)carbamothioylsulfanyl N,N-bis(trideuteriomethyl)carbamodithioate |
| Molecular Weight |
252.51 |
| Molecular Formula |
C6D12N2S4 |
| Canonical SMILES |
[2H]C([2H])([2H])N(C(=S)SSC(=S)N(C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C6H12N2S4/c1-7(2)5(9)11-12-6(10)8(3)4/h1-4H3/i1D3,2D3,3D3,4D3 |
| Storage |
-20 °C |
| Accurate Mass |
252.0637 |
| Format |
Neat |
| Shipping Temperature |
Room temperature |
| SIL Type |
Deuterium |
| Unlabeled CAS |
137-26-8 |
Please kindly note that our products and services are for research use only.
