| Catalog Number |
ACM1086096265 |
| CAS |
1086096-26-5 |
| IUPAC Name |
sodium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecadeuteriodecanoate |
| Molecular Weight |
213.36 |
| Molecular Formula |
C10D19NaO2 |
| InChI |
InChI=1S/C10H20O2.Na/c1-2-3-4-5-6-7-8-9-10(11)12;/h2-9H2,1H3,(H,11,12);/q;+1/p-1/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2; |
| InChI Key |
FIWQZURFGYXCEO-SIEBOIPHSA-M |
| Purity |
98 atom % D |
| Chemical Formula |
CD3(CD2)8CO2Na |
| Exact Mass |
213.24753230 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[Na+] |
| Isotopic Enrichment |
98 atom % D |
| Monoisotopic Mass |
213.24753230 |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Room temperature |
| Unlabeled CAS |
1002-62-6 |
| Unlabeled Synonyms |
Sodium caprate |
