| Catalog Number |
ACM62790265-1 |
| CAS |
62790-26-5 |
| Structure |
 |
| Synonyms |
Benzoic acid-2,3,4,5,6-d5sodium salt |
| IUPAC Name |
sodium;2,3,4,5,6-pentadeuteriobenzoate |
| Molecular Weight |
149.14 |
| Molecular Formula |
C7D5NaO2 |
| InChI |
InChI=1S/C7H6O2.Na/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/q;+1/p-1/i1D,2D,3D,4D,5D; |
| InChI Key |
WXMKPNITSTVMEF-GWVWGMRQSA-M |
| Melting Point |
>300 °C (lit.) |
| Chemical Formula |
C6D5COONa |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)[O-])[2H])[2H].[Na+] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
532-32-1 |
| Unlabeled Synonyms |
Acetic acid, sodium salt |
