| Catalog Number |
ACM39230370-1 |
| CAS |
39230-37-0 |
| Structure |
 |
| Synonyms |
Acetic-D3 acid sodium salt |
| IUPAC Name |
sodium;2,2,2-trideuterioacetate |
| Molecular Weight |
85.05 |
| Molecular Formula |
C2H2D3NaO2 |
| InChI |
InChI=1S/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1/i1D3; |
| InChI Key |
VMHLLURERBWHNL-NIIDSAIPSA-M |
| Melting Point |
>300 °C (dec.) (lit.) |
| Appearance |
White crystalline powder |
| Chemical Formula |
CD3COONa |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C(=O)[O-].[Na+] |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
127-09-3 |
| Unlabeled Synonyms |
Acetic acid, sodium salt |
