Simazine D10 100 µg/mL in Acetone
| Catalog Number |
ACM220621396-3 |
| CAS |
220621-39-6 |
| Structure |
 |
| IUPAC Name |
6-chloro-2-N,4-N-bis(1,1,2,2,2-pentadeuterioethyl)-1,3,5-triazine-2,4-diamine |
| Molecular Weight |
211.72 |
| Molecular Formula |
C7D10H2ClN5 |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])Nc1nc(Cl)nc(NC([2H])([2H])C([2H])([2H])[2H])n1 |
| InChI |
InChI=1S/C7H12ClN5/c1-3-9-6-11-5(8)12-7(13-6)10-4-2/h3-4H2,1-2H3,(H2,9,10,11,12,13)/i1D3,2D3,3D2,4D2 |
| Storage |
+20 °C |
| Accurate Mass |
211.1409 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
122-34-9 |
Please kindly note that our products and services are for research use only.
