Quizalofop (free acid) D3 100 µg/mL in Acetone
| Catalog Number |
ACM2714483620 |
| CAS |
2714483-62-0 |
| Structure |
 |
| Synonyms |
Quizalofop free acid D3 (methyl D3), Quizalofop free acid D3 |
| IUPAC Name |
2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-3,3,3-trideuteriopropanoic acid |
| Molecular Weight |
347.77 |
| Molecular Formula |
C17D3H10ClN2O4 |
| Canonical SMILES |
[2H]C([2H])([2H])C(Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1)C(=O)O |
| InChI |
InChI=1S/C17H13ClN2O4/c1-10(17(21)22)23-12-3-5-13(6-4-12)24-16-9-19-15-8-11(18)2-7-14(15)20-16/h2-10H,1H3,(H,21,22)/i1D3 |
| Storage |
+20 °C |
| Accurate Mass |
347.0752 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
