Quinmerac D4 100 µg/mL in Acetonitrile
| Catalog Number |
ACM2733717047 |
| CAS |
2733717-04-7 |
| Structure |
 |
| IUPAC Name |
7-chloro-2-deuterio-3-(trideuteriomethyl)quinoline-8-carboxylic acid |
| Molecular Weight |
225.66 |
| Molecular Formula |
C11D4H4ClNO2 |
| Canonical SMILES |
[2H]c1nc2c(C(=O)O)c(Cl)ccc2cc1C([2H])([2H])[2H] |
| InChI |
InChI=1S/C11H8ClNO2/c1-6-4-7-2-3-8(12)9(11(14)15)10(7)13-5-6/h2-5H,1H3,(H,14,15)/i1D3,5D |
| Storage |
+20 °C |
| Accurate Mass |
225.0495 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
