Propoxur D3 (methyl D3) 100 µg/mL in Acetone
| Catalog Number |
ACM1219798567-1 |
| CAS |
1219798-56-7 |
| Structure |
 |
| Synonyms |
Propoxur D3 (N-methyl D3), Propoxur D3 (methyl D3) |
| IUPAC Name |
(2-propan-2-yloxyphenyl) N-(trideuteriomethyl)carbamate |
| Molecular Weight |
212.26 |
| Molecular Formula |
C11D3H12NO3 |
| Canonical SMILES |
[2H]C([2H])([2H])NC(=O)Oc1ccccc1OC(C)C |
| InChI |
InChI=1S/C11H15NO3/c1-8(2)14-9-6-4-5-7-10(9)15-11(13)12-3/h4-8H,1-3H3,(H,12,13)/i3D3 |
| Storage |
+20 °C |
| Accurate Mass |
212.124 |
| Alternative CAS |
114-26-1 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
