Propazine D6 (isopropyl D6) 100 µg/mL in Acetone
| Catalog Number |
ACM2733724111 |
| CAS |
2733724-11-1 |
| Structure |
 |
| Synonyms |
Propazine D6 (isopropyl D6) |
| IUPAC Name |
6-chloro-2-N-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-4-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| Molecular Weight |
235.75 |
| Molecular Formula |
C9D6H10ClN5 |
| Canonical SMILES |
[2H]C([2H])([2H])C(Nc1nc(Cl)nc(NC(C)C)n1)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C9H16ClN5/c1-5(2)11-8-13-7(10)14-9(15-8)12-6(3)4/h5-6H,1-4H3,(H2,11,12,13,14,15)/i1D3,2D3 |
| Storage |
+20 °C |
| Accurate Mass |
235.1471 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
