Prometryn D6 (isopropyl D6) 100 µg/mL in Acetone
| Catalog Number |
ACM1705649520-1 |
| CAS |
1705649-52-0 |
| Structure |
 |
| Synonyms |
Prometryn D6 (isopropyl D6) |
| IUPAC Name |
2-N-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-6-methylsulfanyl-4-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| Molecular Weight |
247.39 |
| Molecular Formula |
C10D6H13N5S |
| Canonical SMILES |
[2H]C([2H])([2H])C(Nc1nc(NC(C)C)nc(SC)n1)C([2H])([2H])[2H] |
| InChI |
InChI=1S/C10H19N5S/c1-6(2)11-8-13-9(12-7(3)4)15-10(14-8)16-5/h6-7H,1-5H3,(H2,11,12,13,14,15)/i1D3,2D3 |
| Storage |
+20 °C |
| Accurate Mass |
247.1738 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
