| Catalog Number |
ACM352534953-1 |
| CAS |
352534-95-3 |
| Structure |
 |
| Synonyms |
PIPES-[D18] |
| IUPAC Name |
deuterio 1,1,2,2-tetradeuterio-2-[2,2,3,3,5,5,6,6-octadeuterio-4-(1,1,2,2-tetradeuterio-2-deuteriooxysulfonylethyl)piperazin-1-yl]ethanesulfonate |
| Molecular Weight |
320.47 |
| Molecular Formula |
C8D18N2O6S2 |
| InChI |
InChI=1S/C8H18N2O6S2/c11-17(12,13)7-5-9-1-2-10(4-3-9)6-8-18(14,15)16/h1-8H2,(H,11,12,13)(H,14,15,16)/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,8D2/hD2 |
| InChI Key |
IHPYMWDTONKSCO-SVSBSETCSA-N |
| Melting Point |
>300 °C |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C1(C(N(C(C(N1C([2H])([2H])C([2H])([2H])S(=O)(=O)O[2H])([2H])[2H])([2H])[2H])C([2H])([2H])C([2H])([2H])S(=O)(=O)O[2H])([2H])[2H])[2H] |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
5625-37-6 |
| Unlabeled Synonyms |
1,4-Piperazinediethanesulfonic acid; PIPES |
