| Catalog Number |
ACM190780666-1 |
| CAS |
190780-66-6 |
| Structure |
 |
| Synonyms |
p-Cresol (D8) |
| IUPAC Name |
1,2,4,5-tetradeuterio-3-deuteriooxy-6-(trideuteriomethyl)benzene |
| Molecular Weight |
116.19 |
| Molecular Formula |
C7D8O |
| Canonical SMILES |
[2H]Oc1c([2H])c([2H])c(c([2H])c1[2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C7H8O/c1-6-2-4-7(8)5-3-6/h2-5,8H,1H3/i1D3,2D,3D,4D,5D/hD |
| Purity |
98 atom % D |
| Accurate Mass |
116.1077 |
| Format |
Neat |
| Functional Group |
Alcohols & Phenols |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.5 g
In Stock
1 g
In Stock |
| Shipping Hazards |
TOXIC & CORROSIVE |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
106-44-5 |
