2-Nitrophenol-3,4,5,6-d4 (98 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM93951781-1 |
| CAS |
93951-78-1 |
| Structure |
 |
| Synonyms |
o-Nitrophenol-d4, 2-Hydroxynitrobenzene-d4 |
| IUPAC Name |
2,3,4,5-tetradeuterio-6-nitro-phenol |
| Molecular Weight |
143.13 |
| Molecular Formula |
C6D4HNO3 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(c(O)c1[2H])[N+](=O)[O-] |
| InChI |
InChI=1S/C6H5NO3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H/i1D,2D,3D,4D |
| Accurate Mass |
143.0521 |
| Alternative CAS |
88-75-5 |
| Format |
Neat |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
