| Catalog Number |
ACM33975461 |
| CAS |
33975-46-1 |
| Structure |
 |
| Synonyms |
N-NONYL-6,6,7,7-D4 ALCOHOL |
| IUPAC Name |
6,6,7,7-tetradeuteriononan-1-ol |
| Molecular Weight |
148.28 |
| Molecular Formula |
C9H16D4O |
| InChI |
InChI=1S/C9H20O/c1-2-3-4-5-6-7-8-9-10/h10H,2-9H2,1H3/i3D2,4D2 |
| InChI Key |
ZWRUINPWMLAQRD-KHORGVISSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CH3CH2(CD2)2(CH2)5OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CC)C([2H])([2H])CCCCCO |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
143-08-8 |
| Unlabeled Synonyms |
1-Nonanol |
