| Catalog Number |
ACM110510786 |
| CAS |
110510-78-6 |
| Structure |
 |
| Synonyms |
1-Decanol-d21 |
| IUPAC Name |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosadeuteriodecan-1-ol |
| Molecular Weight |
179.41 |
| Molecular Formula |
C10HD21O |
| InChI |
InChI=1S/C10H22O/c1-2-3-4-5-6-7-8-9-10-11/h11H,2-10H2,1H3/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2 |
| InChI Key |
MWKFXSUHUHTGQN-SLBGAMDCSA-N |
| Melting Point |
179.4 °C |
| Purity |
98 atom % D |
| Chemical Formula |
CD3(CD2)9OH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
112-30-1 |
| Unlabeled Synonyms |
1-Decanol; Capric alcohol; Decylic alcohol; Nonylcarbinol |
