mono-Ethyl Phthalate-3,4,5,6-d4 (99 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM1219806037-3 |
| CAS |
1219806-03-7 |
| Structure |
 |
| IUPAC Name |
2,3,4,5-tetradeuterio-6-ethoxycarbonylbenzoic acid |
| Molecular Weight |
198.21 |
| Molecular Formula |
C10D4H6O4 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(C(=O)OCC)c(C(=O)O)c1[2H] |
| InChI |
InChI=1S/C10H10O4/c1-2-14-10(13)8-6-4-3-5-7(8)9(11)12/h3-6H,2H2,1H3,(H,11,12)/i3D,4D,5D,6D |
| Accurate Mass |
198.083 |
| Format |
Neat |
| SIL Type |
Deuterium |
| Unlabeled CAS |
2306-33-4 |
Please kindly note that our products and services are for research use only.
