Mecoprop D3 (phenyl D3) 100 µg/mL in Acetone
| Catalog Number |
ACM352431153-3 |
| CAS |
352431-15-3 |
| Structure |
 |
| Synonyms |
Propanoic acid, 2-(4-chloro-2-methylphenoxy-2,3,5-d3)- (9CI), Mecoprop D3 (phenyl D3), Mecoprop-d3 |
| IUPAC Name |
2-(4-chloro-2,3,5-trideuterio-6-methylphenoxy)propanoic acid |
| Molecular Weight |
217.66 |
| Molecular Formula |
C10D3H8ClO3 |
| Canonical SMILES |
[2H]c1c([2H])c(OC(C)C(=O)O)c(C)c([2H])c1Cl |
| InChI |
InChI=1S/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13)/i3D,4D,5D |
| Storage |
+20 °C |
| Accurate Mass |
217.0585 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
93-65-2 |
Please kindly note that our products and services are for research use only.
