Malathion D10 (diethyl D10)
| Catalog Number |
ACM347841489-2 |
| CAS |
347841-48-9 |
| Structure |
 |
| IUPAC Name |
bis(1,1,2,2,2-pentadeuterioethyl) 2-dimethoxyphosphinothioylsulfanylbutanedioate |
| Molecular Weight |
340.42 |
| Molecular Formula |
C10D10H9O6PS2 |
| Canonical SMILES |
[2H]C([2H])([2H])C([2H])([2H])OC(=O)CC(SP(=S)(OC)OC)C(=O)OC([2H])([2H])C([2H])([2H])[2H] |
| InChI |
InChI=1S/C10H19O6PS2/c1-5-15-9(11)7-8(10(12)16-6-2)19-17(18,13-3)14-4/h8H,5-7H2,1-4H3/i1D3,2D3,5D2,6D2 |
| Storage |
+4 °C |
| Accurate Mass |
340.0988 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
121-75-5 |
Please kindly note that our products and services are for research use only.
