| Catalog Number |
ACM17714840-1 |
| CAS |
17714-84-0 |
| Structure |
 |
| Synonyms |
m-Terphenyl-d14 (7CI, 8CI), 1,3-Terphenyl-d14, 3-(Phenyl-d5)-1,1'-biphenyl-2,2',3',4,4',5,5',6,6'-d9, 1,1':3',1''-Terphenyl-d14 |
| IUPAC Name |
1,2,3,4,5-pentadeuterio-6-[2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene |
| Molecular Weight |
244.39 |
| Molecular Formula |
C18D14 |
| Canonical SMILES |
[2H]c1c([2H])c([2H])c(c([2H])c1[2H])c2c([2H])c([2H])c([2H])c(c2[2H])c3c([2H])c([2H])c([2H])c([2H])c3[2H] |
| InChI |
InChI=1S/C18H14/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16/h1-14H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D |
| Purity |
98 atom % D |
| Accurate Mass |
244.1974 |
| Format |
Neat |
| Functional Group |
Hydrocarbons - Other Aromatic |
| Isotopic Enrichment |
98 atom % D |
| Packaging |
0.5 g
In Stock
1 g
In Stock |
| Shipping Hazards |
NON-HAZARDOUS FOR TRANSPORT |
| SIL Type |
Deuterium |
| Stability |
Stable if stored under recommended conditions (see section 7 of SDS). After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
92-06-8 |
