| Catalog Number |
ACM65807229 |
| CAS |
65807-22-9 |
| Synonyms |
L-Proline-d3 |
| IUPAC Name |
(2S)-2,5,5-trideuteriopyrrolidine-2-carboxylic acid |
| Molecular Weight |
118.15 |
| Molecular Formula |
C5H6D3NO2 |
| Canonical SMILES |
[2H][C@]1(CCC(N1)([2H])[2H])C(=O)O |
| InChI |
InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1/i3D2,4D |
| InChI Key |
ONIBWKKTOPOVIA-KIZNEYSQSA-N |
| Purity |
98 atom % D |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H][C@]1(CCC(N1)([2H])[2H])C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
147-85-3 |
| Unlabeled Synonyms |
(S)-Pyrrolidine-2-carboxylic acid; H-L-Pro-OH |
