| Catalog Number |
ACM502692582-1 |
| CAS |
502692-58-2 |
| Structure |
 |
| IUPAC Name |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(trideuteriomethylsulfanyl)butanoic acid |
| Molecular Weight |
374.47 |
| Molecular Formula |
C20H18D3NO4S |
| Canonical SMILES |
[2H]C([2H])([2H])SCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| InChI |
InChI=1S/C20H21NO4S/c1-26-11-10-18(19(22)23)21-20(24)25-12-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,17-18H,10-12H2,1H3,(H,21,24)(H,22,23)/t18-/m0/s1/i1D3 |
| InChI Key |
BUBGAUHBELNDEW-CAGSJYCBSA-N |
| Purity |
97% |
| Chemical Formula |
CD3SCH2CH2CH(NH-FMOC)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
71989-28-1 |
| Unlabeled Synonyms |
FMOC-L-Methionine; FMOC-L-Met-OH |
