| Catalog Number |
ACM538372746-1 |
| CAS |
538372-74-6 |
| Structure |
 |
| IUPAC Name |
5,5,5-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoic acid |
| Molecular Weight |
356.44 |
| Molecular Formula |
C21H20D3NO4 |
| Canonical SMILES |
[2H]C([2H])([2H])C(C)CC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| InChI |
InChI=1S/C21H23NO4/c1-13(2)11-19(20(23)24)22-21(25)26-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19H,11-12H2,1-2H3,(H,22,25)(H,23,24)/i1D3 |
| InChI Key |
CBPJQFCAFFNICX-FIBGUPNXSA-N |
| Chemical Formula |
CH3CH(CD3)CH2CH(NH-FMOC)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
35661-60-0 |
| Unlabeled Synonyms |
FMOC-L-leucine; FMOC-L-Leu-OH |
