| Catalog Number |
ACM2784501-1 |
| CAS |
2784-50-1 |
| Structure |
 |
| Synonyms |
Glutamicol-D5; L-Glutamic acid-D5 |
| IUPAC Name |
(2S)-2-amino-2,3,3,4,4-pentadeuteriopentanedioic acid |
| Molecular Weight |
152.16 |
| Molecular Formula |
C5H4D5NO4 |
| Canonical SMILES |
[2H][C@@](C(=O)O)(C([2H])([2H])C([2H])([2H])C(=O)O)N |
| InChI |
InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/i1D2,2D2,3D |
| InChI Key |
WHUUTDBJXJRKMK-NKXUJHECSA-N |
| Melting Point |
205 °C (dec.) (lit.) |
| Density |
1.54 g/cm3 at 20 °C (68 °F) |
| Appearance |
White solid |
| Chemical Formula |
HOOCCD2CD2CD(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H][C@@](C(=O)O)(C([2H])([2H])C([2H])([2H])C(=O)O)N |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
56-86-0 |
| Unlabeled Synonyms |
(S)-2-Aminoglutaric acid; H-L-Glu-OH |
