| Catalog Number |
ACM63546270 |
| CAS |
63546-27-0 |
| Structure |
 |
| Synonyms |
N-Acetyl-D-glucosamine-D3; [3,3,3-2H3]-L-Alanine; (2S)-2-Amino-3,3,3-trideuteriopropanoic acid |
| IUPAC Name |
2,2,2-trideuterio-N-[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| Molecular Weight |
92.11 |
| Molecular Formula |
C3H4D3NO2 |
| Canonical SMILES |
[2H]C([2H])([2H])[C@@H](C(=O)O)N |
| InChI |
InChI=1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-,8?/m1/s1/i1D3 |
| InChI Key |
OVRNDRQMDRJTHS-OSEDBHPGSA-N |
| Melting Point |
314.5 °C (dec.) (lit.) |
| Purity |
99 atom % D |
| Chemical Formula |
CD3CH(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C(=O)N[C@@H]1[C@H]([C@@H]([C@H](OC1O)CO)O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
56-41-7 |
| Unlabeled Synonyms |
(S)-2-Aminopropanoic acid; H-L-Ala-OH |
