| Catalog Number |
ACM18806296 |
| CAS |
18806-29-6 |
| Structure |
 |
| Synonyms |
2,3,3,3-TetradeuterioL-alanine; L-(2,3,3,3-(2)H4)Alanine |
| IUPAC Name |
(2S)-2-amino-2,3,3,3-tetradeuteriopropanoic acid |
| Molecular Weight |
93.12 |
| Molecular Formula |
C3H3D4NO2 |
| Canonical SMILES |
[2H][C@@](C(=O)O)(C([2H])([2H])[2H])N |
| InChI |
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1D3,2D |
| InChI Key |
QNAYBMKLOCPYGJ-IALWIIEESA-N |
| Melting Point |
314.5 °C (dec.) (lit.) |
| Purity |
98 atom % D |
| Chemical Formula |
CD3CD(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H][C@@](C(=O)O)(C([2H])([2H])[2H])N |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
56-41-7 |
| Unlabeled Synonyms |
(S)-2-Aminopropanoic acid; H-L-Ala-OH |
