| Catalog Number |
ACM312623851-1 |
| CAS |
312623-85-1 |
| Structure |
 |
| Synonyms |
L-Alanine (U-13C3; 15N) |
| IUPAC Name |
(2S)-2-(15N)azanyl(1,2,3-13C3)propanoic acid |
| Molecular Weight |
93.07 |
| Molecular Formula |
13C3H715NO2 |
| Canonical SMILES |
[13CH3][13C@@H]([13C](=O)O)[15NH2] |
| InChI |
InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1+1,2+1,3+1,4+1 |
| InChI Key |
QNAYBMKLOCPYGJ-UVYXLFMMSA-N |
| Melting Point |
314.5 °C (dec.) (lit.) |
| Chemical Formula |
*CH3*CH(*NH2)*COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
99 atom % 13C; 99 atom % 15N |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
56-41-7 |
| Unlabeled Synonyms |
(S)-2-Aminopropanoic acid; H-L-Ala-OH |
