| Catalog Number |
ACM57746153-1 |
| CAS |
57746-15-3 |
| Structure |
 |
| Synonyms |
L-Tyrosine-2,6-D2 |
| IUPAC Name |
(2S)-2-amino-3-(2,6-dideuterio-4-hydroxyphenyl)propanoic acid |
| Molecular Weight |
183.20 |
| Molecular Formula |
C9H9D2NO3 |
| Canonical SMILES |
[2H]C1=CC(=CC(=C1C[C@@H](C(=O)O)N)[2H])O |
| InChI |
InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1D,2D |
| InChI Key |
OUYCCCASQSFEME-RANRWVQCSA-N |
| Melting Point |
>300 °C (dec.) (lit.) |
| Chemical Formula |
HOC6H2D2CH2CH(NH2)COOH |
| Hazards |
Non-hazardous for transport. |
| Isotopic Enrichment |
97 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
60-18-4 |
| Unlabeled Synonyms |
L-Tyrosine; p-Hydroxyphenyl-L-alanine; H-L-Tyr-OH |
