| Catalog Number |
ACM1015855830-2 |
| CAS |
1015855-83-0 |
| Structure |
 |
| Synonyms |
1H-Imidazole, 1-(methyl-d3)-2-(1-methylethyl)-5-nitro-, Ipronidazole D3, Ipronidazole D3 (N-methyl D3) |
| IUPAC Name |
5-nitro-2-propan-2-yl-1-(trideuteriomethyl)imidazole |
| Molecular Weight |
172.2 |
| Molecular Formula |
C7D3H8N3O2 |
| Canonical SMILES |
[2H]C([2H])([2H])n1c(ncc1[N+](=O)[O-])C(C)C |
| InChI |
InChI=1S/C7H11N3O2/c1-5(2)7-8-4-6(9(7)3)10(11)12/h4-5H,1-3H3/i3D3 |
| Storage |
+20 °C |
| Accurate Mass |
172.104 |
| Format |
Neat |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
| Unlabeled CAS |
14885-29-1 |
Please kindly note that our products and services are for research use only.
