| Catalog Number |
ACM52089653-1 |
| CAS |
52089-65-3 |
| Structure |
 |
| Synonyms |
Adipic acid-d8 |
| IUPAC Name |
2,2,3,3,4,4,5,5-octadeuteriohexanedioic acid |
| Molecular Weight |
154.19 |
| Molecular Formula |
C6H2D8O4 |
| InChI |
InChI=1S/C6H10O4/c7-5(8)3-1-2-4-6(9)10/h1-4H2,(H,7,8)(H,9,10)/i1D2,2D2,3D2,4D2 |
| InChI Key |
WNLRTRBMVRJNCN-SVYQBANQSA-N |
| Chemical Formula |
HOOC(CD2)4COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
124-04-9 |
| Unlabeled Synonyms |
Adipic acid |
