| Catalog Number |
ACM39756304 |
| CAS |
39756-30-4 |
| Structure |
 |
| Synonyms |
Palmitic-D31 acid; Hexadecanoic-[D31] acid |
| IUPAC Name |
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-hentriacontadeuteriohexadecanoic acid |
| Molecular Weight |
287.62 |
| Molecular Formula |
C16HD31O2 |
| Canonical SMILES |
CCCCCCCCCCCCCCCC(=O)O |
| InChI |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2 |
| InChI Key |
IPCSVZSSVZVIGE-SAQPIRCFSA-N |
| Boiling Point |
271.5 °C at 100 mmHg (lit.) |
| Melting Point |
61-64 °C (lit.) |
| Flash Point |
154.1ºC |
| Purity |
98 atom % D |
| Density |
0.868 g/mL at 25 °C |
| Appearance |
Neat |
| Chemical Formula |
CD3(CD2)14COOH |
| Exact Mass |
256.24000 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-10-3 |
| Unlabeled Synonyms |
Palmitic acid; Cetylic acid; Hexadecylic acid |
