Catalog Number |
ACM81462284 |
CAS |
81462-28-4 |
Structure |
 |
Synonyms |
HEXADECANOIC-9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-D17 ACID;Hexadecanoic Acid-9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-D17 |
IUPAC Name |
9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-heptadecadeuteriohexadecanoic acid |
Molecular Weight |
273.53 |
Molecular Formula |
C16H15D17O2 |
InChI |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2 |
InChI Key |
IPCSVZSSVZVIGE-OISRNESJSA-N |
Purity |
98 atom % D |
Chemical Formula |
CD3(CD2)7(CH2)7COOH |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])CCCCCCCC(=O)O |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
CAS (Unlabeled) |
57-10-3 |
Synonyms (Unlabeled) |
Palmitic acid; Cetylic acid; Hexadecylic acid |