| Catalog Number |
ACM75736479 |
| CAS |
75736-47-9 |
| Structure |
 |
| Synonyms |
Palmitic acid-D4 |
| IUPAC Name |
5,5,6,6-tetradeuteriohexadecanoic acid |
| Molecular Weight |
260.45 |
| Molecular Formula |
C16H28D4O2 |
| Canonical SMILES |
CCCCCCCCCCCCCCCC(=O)O |
| InChI |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i11D2,12D2 |
| InChI Key |
IPCSVZSSVZVIGE-AREBVXNXSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CH3(CH2)9(CD2)2(CH2)3COOH |
| Exact Mass |
260.26500 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CCCCCCCCCC)C([2H])([2H])CCCC(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-10-3 |
| Unlabeled Synonyms |
Palmitic acid, Cetylic acid; Hexadecylic acid |
