| Catalog Number |
ACM30719289 |
| CAS |
30719-28-9 |
| Structure |
 |
| Synonyms |
4,4-Dideuterio-hexadecanoic acid |
| IUPAC Name |
4,4-dideuteriohexadecanoic acid |
| Molecular Weight |
258.44 |
| Molecular Formula |
C16H30D2O2 |
| InChI |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i13D2 |
| InChI Key |
IPCSVZSSVZVIGE-KLTYLHELSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CH3(CH2)11CD2(CH2)2COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CCCCCCCCCCCC)CCC(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-10-3 |
| Unlabeled Synonyms |
Palmitic acid, Cetylic acid; Hexadecylic acid |
