| Catalog Number |
ACM1219802615-1 |
| CAS |
1219802-61-5 |
| Structure |
 |
| IUPAC Name |
2,2,16,16,16-pentadeuteriohexadecanoic acid |
| Molecular Weight |
261.46 |
| Molecular Formula |
C16H27D5O2 |
| InChI |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i1D3,15D2 |
| InChI Key |
IPCSVZSSVZVIGE-GJZIZAJSSA-N |
| Chemical Formula |
CD3(CH2)13CD2COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCCCCCCC([2H])([2H])C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-10-3 |
| Unlabeled Synonyms |
Palmitic acid; Cetylic acid; Hexadecylic acid |
