| Catalog Number |
ACM75736537-1 |
| CAS |
75736-53-7 |
| Synonyms |
Palmitic acid-16,16,16-D3 |
| IUPAC Name |
16,16,16-trideuteriohexadecanoic acid |
| Molecular Weight |
259.45 |
| Molecular Formula |
C16H29D3O2 |
| InChI |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i1D3 |
| InChI Key |
IPCSVZSSVZVIGE-FIBGUPNXSA-N |
| Melting Point |
61-64 °C |
| Chemical Formula |
CD3(CH2)14COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCCCCCCCC(=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-10-3 |
| Unlabeled Synonyms |
Palmitic acid, Cetylic acid; Hexadecylic acid |
