| Catalog Number |
ACM75736571-1 |
| CAS |
75736-57-1 |
| Structure |
 |
| Synonyms |
11,11,12,12-Tetradeuteriohexadecanoic acid |
| IUPAC Name |
11,11,12,12-tetradeuteriohexadecanoic acid |
| Molecular Weight |
260.45 |
| Molecular Formula |
C16H28D4O2 |
| InChI |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i5D2,6D2 |
| InChI Key |
IPCSVZSSVZVIGE-NZLXMSDQSA-N |
| Chemical Formula |
CH3(CH2)3(CD2)2(CH2)9COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(CCCC)C([2H])([2H])CCCCCCCCCC(=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
57-10-3 |
| Unlabeled Synonyms |
Palmitic acid; Cetylic acid; Hexadecylic acid |
