Catalog Number |
ACM285979784 |
CAS |
285979-78-4 |
Structure |
 |
Synonyms |
Glyceryl tripalmitin-[d9] |
IUPAC Name |
2,3-bis(16,16,16-trideuteriohexadecanoyloxy)propyl 16,16,16-trideuteriohexadecanoate |
Molecular Weight |
816.39 |
Molecular Formula |
C51H89D9O6 |
InChI |
InChI=1S/C51H98O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-49(52)55-46-48(57-51(54)45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)47-56-50(53)44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h48H,4-47H2,1-3H3/i1D3,2D3,3D3 |
InChI Key |
PVNIQBQSYATKKL-GQALSZNTSA-N |
Melting Point |
64-66 °C (lit.) |
Purity |
99 atom % D |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCC([2H])([2H])[2H])OC(=O)CCCCCCCCCCCCCCC([2H])([2H])[2H] |
Isotopic Enrichment |
99 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
CAS (Unlabeled) |
555-44-2 |
Synonyms (Unlabeled) |
Glyceryl tripalmitate; Tripalmitin |