| Catalog Number |
ACM62502710 |
| CAS |
62502-71-0 |
| Structure |
 |
| Synonyms |
1,2,3-Propanetriol-1,1,2,3,3-d5; Glycerol-d5 |
| IUPAC Name |
1,1,2,3,3-pentadeuteriopropane-1,2,3-triol |
| Molecular Weight |
97.12 |
| Molecular Formula |
C3H3D5O3 |
| InChI |
InChI=1S/C3H8O3/c4-1-3(6)2-5/h3-6H,1-2H2/i1D2,2D2,3D |
| InChI Key |
PEDCQBHIVMGVHV-UXXIZXEISA-N |
| Boiling Point |
182 °C (lit.) |
| Melting Point |
20 °C (lit.) |
| Flash Point |
320 °F |
| Density |
1.331 g/mL at 25 °C |
| Appearance |
Colorless viscous oil |
| Chemical Formula |
(HOCD2)2CDOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])(C([2H])(C([2H])([2H])O)O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
56-81-5 |
| Unlabeled Synonyms |
Glycerin; 1,2,3-Propanetriol |
