Catalog Number |
ACM53866345 |
CAS |
53866-34-5 |
Structure |
 |
Synonyms |
1,3,5(10)-Estratrien-3-ol-17-one-d4; 3-Hydroxy-17-keto-estra-1,3,5-triene-d4 |
IUPAC Name |
(8R,9S,13S,14S)-2,4,16,16-tetradeuterio-3-hydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-one |
Molecular Weight |
274.39 |
Molecular Formula |
C18H18D4O2 |
InChI |
InChI=1S/C18H22O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-16,19H,2,4,6-9H2,1H3/t14-,15-,16+,18+/m1/s1/i3D,7D2,10D |
InChI Key |
DNXHEGUUPJUMQT-QSPUTOQOSA-N |
Melting Point |
258-260 °C (lit.) |
Purity |
98 atom % D |
Appearance |
White solid |
Hazards |
Non-hazardous for transport. |
Isomeric SMILES |
[2H]C1=CC2=C(CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC(C4=O)([2H])[2H])C)C(=C1O)[2H] |
Isotopic Enrichment |
98 atom % D |
Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
Storage Conditions |
Store at room temperature |
CAS (Unlabeled) |
53-16-7 |
Synonyms (Unlabeled) |
3-Hydroxy-1,3,5(10)-estratrien-17-one; 1,3,5(10)-Estratrien-3-ol-17-one; Folliculin |