DNOC D5 (ring D2, methyl D3) 100 µg/mL in Acetone
| Catalog Number |
ACM2733269651 |
| CAS |
2733269-65-1 |
| Structure |
 |
| IUPAC Name |
3,5-dideuterio-2,4-dinitro-6-(trideuteriomethyl)phenol |
| Molecular Weight |
203.16 |
| Molecular Formula |
C7D5HN2O5 |
| Canonical SMILES |
[2H]c1c(c([2H])c(c(O)c1[N+](=O)[O-])C([2H])([2H])[2H])[N+](=O)[O-] |
| InChI |
InChI=1S/C7H6N2O5/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14/h2-3,10H,1H3/i1D3,2D,3D |
| Storage |
+20 °C |
| Accurate Mass |
203.0591 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
