Dicofol D8 100 µg/mL in Cyclohexane
| Catalog Number |
ACM2714413202 |
| CAS |
2714413-20-2 |
| Structure |
 |
| Synonyms |
Dicofol D8 (ring D8) |
| IUPAC Name |
2,2,2-trichloro-1,1-bis(4-chloro-2,3,5,6-tetradeuteriophenyl)ethanol |
| Molecular Weight |
378.54 |
| Molecular Formula |
C14D8HCl5O |
| Canonical SMILES |
[2H]c1c([2H])c(c([2H])c([2H])c1Cl)C(O)(c2c([2H])c([2H])c(Cl)c([2H])c2[2H])C(Cl)(Cl)Cl |
| InChI |
InChI=1S/C14H9Cl5O/c15-11-5-1-9(2-6-11)13(20,14(17,18)19)10-3-7-12(16)8-4-10/h1-8,20H/i1D,2D,3D,4D,5D,6D,7D,8D |
| Storage |
+20 °C |
| Accurate Mass |
375.9598 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
