4,4'-Dichlorobenzophenone D8 100 µg/mL in Acetone
| Catalog Number |
ACM1219806015-3 |
| CAS |
1219806-01-5 |
| Structure |
 |
| IUPAC Name |
bis(4-chloro-2,3,5,6-tetradeuteriophenyl)methanone |
| Molecular Weight |
259.16 |
| Molecular Formula |
C13D8Cl2O |
| Canonical SMILES |
[2H]c1c([2H])c(C(=O)c2c([2H])c([2H])c(Cl)c([2H])c2[2H])c([2H])c([2H])c1Cl |
| InChI |
InChI=1S/C13H8Cl2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| Storage |
+20 °C |
| Accurate Mass |
258.0454 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
