Dicamba D4 (phenyl D1 methoxy D3) 100 µg/mL in Acetone
| Catalog Number |
ACM2733718471 |
| CAS |
2733718-47-1 |
| Structure |
 |
| Synonyms |
Dicamba D4 (phenyl D1 methoxy D3) |
| IUPAC Name |
2,5-dichloro-3-deuterio-6-(trideuteriomethoxy)benzoic acid |
| Molecular Weight |
225.06 |
| Molecular Formula |
C8D4H2Cl2O3 |
| Canonical SMILES |
[2H]c1cc(Cl)c(OC([2H])([2H])[2H])c(C(=O)O)c1Cl |
| InChI |
InChI=1S/C8H6Cl2O3/c1-13-7-5(10)3-2-4(9)6(7)8(11)12/h2-3H,1H3,(H,11,12)/i1D3,2D |
| Storage |
+20 °C |
| Accurate Mass |
223.9945 |
| Format |
Single Solution |
| Shipping Temperature |
+20 °C |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
