2,6-Dibromophenol-3,4,5-d3 (98 atom % D, min 98% Chemical Purity)
| Catalog Number |
ACM1219803141-1 |
| CAS |
1219803-14-1 |
| Structure |
 |
| Synonyms |
2,6-Dibromophenol D3, 2,6-Dibromophenol (ring-D3), 2,6-Dibromophenol-3,4,5-D3, 2,6-Dibromo-3,4,5-trideuteriophenol D3 |
| IUPAC Name |
2,6-dibromo-3,4,5-trideuteriophenol |
| Molecular Weight |
254.92 |
| Molecular Formula |
C6D3HBr2O |
| Canonical SMILES |
[2H]c1c([2H])c(Br)c(O)c(Br)c1[2H] |
| InChI |
InChI=1S/C6H4Br2O/c7-4-2-1-3-5(8)6(4)9/h1-3,9H/i1D,2D,3D |
| Accurate Mass |
252.8817 |
| Format |
Neat |
| SIL Type |
Deuterium |
Please kindly note that our products and services are for research use only.
