| Catalog Number |
ACM52886370 |
| CAS |
52886-37-0 |
| Structure |
 |
| Synonyms |
3α,12α-Dihydroxy-(5β)-[24-13C]cholan-24-oic acid |
| IUPAC Name |
(4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl](1-13C)pentanoic acid |
| Molecular Weight |
393.59 |
| Molecular Formula |
13CC23H40O4 |
| InChI |
InChI=1S/C24H40O4/c1-14(4-9-22(27)28)18-7-8-19-17-6-5-15-12-16(25)10-11-23(15,2)20(17)13-21(26)24(18,19)3/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16-,17+,18-,19+,20+,21+,23+,24-/m1/s1/i22+1 |
| InChI Key |
KXGVEGMKQFWNSR-JJUQXLBJSA-N |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
C[C@H](CC[13C](=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C |
| Isotopic Enrichment |
99 atom % 13C |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
83-44-3 |
| Unlabeled Synonyms |
3α,12α-Dihydroxy-5β-cholanic acid; 7-Deoxycholic acid; Desoxycholic acid |
