| Catalog Number |
ACM88170223 |
| CAS |
88170-22-3 |
| Structure |
 |
| Synonyms |
D19-Decanoic acid; Decanoic acid-[D19] |
| IUPAC Name |
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecadeuteriodecanoic acid |
| Molecular Weight |
191.38 |
| Molecular Formula |
C10HD19O2 |
| Canonical SMILES |
CCCCCCCCCC(=O)O |
| InChI |
InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2 |
| InChI Key |
GHVNFZFCNZKVNT-KIJKOTCYSA-N |
| Boiling Point |
268-270 °C (lit.) |
| Melting Point |
30-32 °C (lit.) |
| Purity |
98 atom % D |
| Density |
0.991 g/mL at 25 °C |
| Chemical Formula |
CD3(CD2)8COOH |
| Exact Mass |
191.26600 |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
334-48-5 |
| Unlabeled Synonyms |
Capric acid; 1-Nonanecarboxylic acid |
