| Catalog Number |
ACM62716498 |
| CAS |
62716-49-8 |
| Structure |
 |
| Synonyms |
2,2-Dideuteriodecanoic acid; D2-Decanoic acid |
| IUPAC Name |
2,2-dideuteriodecanoic acid |
| Molecular Weight |
174.28 |
| Molecular Formula |
C10H18D2O2 |
| InChI |
InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)/i9D2 |
| InChI Key |
GHVNFZFCNZKVNT-KNXIQCGSSA-N |
| Purity |
98 atom % D |
| Chemical Formula |
CH3(CH2)7CD2COOH |
| Isomeric SMILES |
[2H]C([2H])(CCCCCCCC)C(=O)O |
| Isotopic Enrichment |
98 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
334-48-5 |
| Unlabeled Synonyms |
Capric acid; 1-Nonanecarboxylic acid |
