Decanoic-10,10,10-d3 acid
| Catalog Number |
ACM102611154-1 |
| CAS |
102611-15-4 |
| Structure |
 |
| Synonyms |
Decanoic-10,10,10-D3 acid |
| IUPAC Name |
10,10,10-trideuteriodecanoic acid |
| Molecular Weight |
175.29 |
| Molecular Formula |
C10H17D3O2 |
| InChI |
InChI=1S/C10H20O2/c1-2-3-4-5-6-7-8-9-10(11)12/h2-9H2,1H3,(H,11,12)/i1D3 |
| InChI Key |
GHVNFZFCNZKVNT-FIBGUPNXSA-N |
| Boiling Point |
268-270 °C (lit.) |
| Melting Point |
30-32 °C (lit.) |
| Density |
0.908 g/mL at 25 °C |
| Chemical Formula |
CD3(CH2)8COOH |
| Hazards |
Non-hazardous for transport. |
| Isomeric SMILES |
[2H]C([2H])([2H])CCCCCCCCC(=O)O |
| Isotopic Enrichment |
99 atom % D |
| Stability |
Stable if stored under recommended conditions. After three years, the compound should be re-analyzed for chemical purity before use. |
| Storage Conditions |
Store at room temperature |
| Unlabeled CAS |
334-48-5 |
| Unlabeled Synonyms |
Capric acid; 1-Nonanecarboxylic acid |
Please kindly note that our products and services are for research use only.
